CAS 1179361-01-3
:2-Pyridinecarboximidamide, 4-phenyl-, hydrochloride (1:1)
Description:
2-Pyridinecarboximidamide, 4-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and phenyl functional groups, which contribute to its unique properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The compound features a carboximidamide functional group, which can exhibit basic properties, making it potentially useful in various chemical reactions and applications, including medicinal chemistry and as a building block in organic synthesis. Its structure allows for potential interactions with biological targets, which may be of interest in pharmaceutical research. As with many chemical substances, handling should be done with care, following appropriate safety protocols, as it may have specific health and environmental considerations. Overall, 2-Pyridinecarboximidamide, 4-phenyl-, hydrochloride is a compound of interest in both academic and industrial chemistry contexts.
Formula:C12H11N3·ClH
InChI:InChI=1S/C12H11N3.ClH/c13-12(14)11-8-10(6-7-15-11)9-4-2-1-3-5-9;/h1-8H,(H3,13,14);1H
InChI key:InChIKey=MZUBDHQXEYJYIC-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=CC(=CC=N1)C2=CC=CC=C2.Cl
Synonyms:- 2-Pyridinecarboximidamide, 4-phenyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
