
CAS 1179361-38-6
:Carbamic acid, N-(2-aminopropyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Description:
Carbamic acid, N-(2-aminopropyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1), with CAS number 1179361-38-6, is a chemical compound characterized by its structure, which includes a carbamic acid moiety linked to an amino group and an isopropyl ester. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It is often used in pharmaceutical applications, particularly as a potential intermediate in the synthesis of biologically active molecules. The presence of the amino group suggests potential for interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological activity and mechanism of action. As with many chemical substances, proper handling and safety measures should be observed, given the potential for toxicity or reactivity.
Formula:C8H18N2O2·ClH
InChI:InChI=1S/C8H18N2O2.ClH/c1-6(9)5-10-7(11)12-8(2,3)4;/h6H,5,9H2,1-4H3,(H,10,11);1H
InChI key:InChIKey=NXKQBPNSELZLGM-UHFFFAOYSA-N
SMILES:O(C(NCC(C)N)=O)C(C)(C)C.Cl
Synonyms:- 1-N-Boc-Propane-1,2-diamine hydrochloride
- Carbamic acid, N-(2-aminopropyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
