CymitQuimica logo

CAS 1179361-50-2

:

Carbamic acid, N-(4-aminocyclohexyl)-, phenylmethyl ester, hydrochloride (1:1)

Description:
Carbamic acid, N-(4-aminocyclohexyl)-, phenylmethyl ester, hydrochloride (1:1), with CAS number 1179361-50-2, is a chemical compound characterized by its structural features that include a carbamic acid moiety and an amine group. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, which is indicative of its polar functional groups. The presence of the hydrochloride salt form suggests enhanced stability and solubility in aqueous environments, making it suitable for various applications, potentially in pharmaceuticals or as an intermediate in organic synthesis. The compound's amine functionality may impart basic properties, while the ester group can influence its reactivity and interaction with biological systems. Additionally, the cyclohexyl and phenyl groups contribute to its hydrophobic characteristics, which can affect its overall bioavailability and pharmacokinetics. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C14H20N2O2·ClH
InChI:InChI=1S/C14H20N2O2.ClH/c15-12-6-8-13(9-7-12)16-14(17)18-10-11-4-2-1-3-5-11;/h1-5,12-13H,6-10,15H2,(H,16,17);1H
InChI key:InChIKey=BGSJXIDHZPOBBW-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)C2CCC(N)CC2.Cl
Synonyms:
  • Carbamic acid, N-(4-aminocyclohexyl)-, phenylmethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.