
CAS 1179361-53-5
:1-Piperazinecarboxylic acid, 2-propyl-, phenylmethyl ester, hydrochloride (1:1)
Description:
1-Piperazinecarboxylic acid, 2-propyl-, phenylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a carboxylic acid derivative with a propyl group and a phenylmethyl ester moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The presence of the piperazine structure often indicates potential pharmacological activity, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. The compound's molecular structure suggests it may exhibit characteristics such as moderate to high polarity, which can influence its interaction with biological systems. Additionally, the ester functionality may provide opportunities for further chemical modifications, making it a versatile candidate in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C15H22N2O2·ClH
InChI:InChI=1S/C15H22N2O2.ClH/c1-2-6-14-11-16-9-10-17(14)15(18)19-12-13-7-4-3-5-8-13;/h3-5,7-8,14,16H,2,6,9-12H2,1H3;1H
InChI key:InChIKey=ZKELFSSEDAZDDR-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C(CCC)CNCC2.Cl
Synonyms:- 1-Piperazinecarboxylic acid, 2-propyl-, phenylmethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzyl 2-propylpiperazine-1-carboxylate hydrochloride
CAS:Formula:C15H23ClN2O2Molecular weight:298.8083
