CAS 1179361-99-9
:2-Pyridinecarboximidamide, 4-(4-fluorophenoxy)-, hydrochloride (1:1)
Description:
2-Pyridinecarboximidamide, 4-(4-fluorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboximidamide functional group. The presence of a 4-fluorophenoxy substituent enhances its potential for biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including drug formulation and biological assays. The compound's molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic rings, contributing to its stability and reactivity. Its specific properties, such as melting point, solubility, and spectral characteristics, would be determined through experimental methods. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.
Formula:C12H10FN3O·ClH
InChI:InChI=1S/C12H10FN3O.ClH/c13-8-1-3-9(4-2-8)17-10-5-6-16-11(7-10)12(14)15;/h1-7H,(H3,14,15);1H
InChI key:InChIKey=FJSKESOIDVFYOP-UHFFFAOYSA-N
SMILES:O(C=1C=C(C(=N)N)N=CC1)C2=CC=C(F)C=C2.Cl
Synonyms:- 2-Pyridinecarboximidamide, 4-(4-fluorophenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
