
CAS 1179362-04-9
:2-Pyridinecarboximidamide, 3-chloro-6-(1,1-dimethylethoxy)-, hydrochloride (1:1)
Description:
2-Pyridinecarboximidamide, 3-chloro-6-(1,1-dimethylethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a carboximidamide functional group indicates that it has both amine and imine characteristics, contributing to its potential reactivity and biological activity. The compound also features a chloro substituent and a tert-butoxy group, which can influence its solubility and stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in various applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. However, specific applications, toxicity, and safety data should be referenced from reliable sources for practical use.
Formula:C10H14ClN3O·ClH
InChI:InChI=1S/C10H14ClN3O.ClH/c1-10(2,3)15-7-5-4-6(11)8(14-7)9(12)13;/h4-5H,1-3H3,(H3,12,13);1H
InChI key:InChIKey=QTOZZMPGADXSAQ-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C=1N=C(C(=N)N)C(Cl)=CC1.Cl
Synonyms:- 2-Pyridinecarboximidamide, 3-chloro-6-(1,1-dimethylethoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(tert-Butoxy)-3-chloropicolinimidamide hydrochloride
CAS:Formula:C10H15Cl2N3OMolecular weight:264.1516
