CAS 1179362-07-2
:2-Pyridinecarboximidamide, 4-(3-fluorophenoxy)-, hydrochloride (1:1)
Description:
2-Pyridinecarboximidamide, 4-(3-fluorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboximidamide functional group. The presence of a 3-fluorophenoxy substituent enhances its chemical properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the electron-withdrawing fluorine atom, which can affect the compound's overall polarity and reactivity. Additionally, the hydrochloride form can stabilize the compound and improve its handling characteristics. Overall, this substance is notable for its potential applications in drug development and research, particularly in areas related to its biological activity and mechanism of action.
Formula:C12H10FN3O·ClH
InChI:InChI=1S/C12H10FN3O.ClH/c13-8-2-1-3-9(6-8)17-10-4-5-16-11(7-10)12(14)15;/h1-7H,(H3,14,15);1H
InChI key:InChIKey=TWYLCZJOHHCYLV-UHFFFAOYSA-N
SMILES:O(C=1C=C(C(=N)N)N=CC1)C2=CC(F)=CC=C2.Cl
Synonyms:- 2-Pyridinecarboximidamide, 4-(3-fluorophenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
