CAS 1179362-17-4

2-Pyridinecarboximidamide, 4-fluoro-, hydrochloride (1:1)

Description:

2-Pyridinecarboximidamide, 4-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a carboximidamide functional group indicates that it has both amine and imine characteristics, contributing to its potential reactivity and biological activity. The 4-fluoro substitution on the pyridine ring enhances its electronic properties, potentially influencing its interaction with biological targets or its solubility in various solvents. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific pharmacological properties. However, detailed studies would be necessary to fully understand its behavior, potential applications, and safety profile.

Formula: C₆H₆FN₃·ClH

InChI: InChI=1S/C6H6FN3.ClH/c7-4-1-2-10-5(3-4)6(8)9;/h1-3H,(H3,8,9);1H

InChI key: InChIKey=QAQHIPSVHGDEAD-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC(F)=CC=N1.Cl

Synonyms:

• 2-Pyridinecarboximidamide, 4-fluoro-, hydrochloride (1:1)

2'-Oxospiro[cyclopropane-1,3'-indoline]-2-carboxylic acid

CAS: 1179362-17-4

Formula: C₆H₇ClFN₃

Molecular weight: 175.5913

Ref: IN-DA008ZZ6

4-Fluoropicolinimidamide hydrochloride

CAS: 1179362-17-4

Versatile small molecule scaffold

Formula: C₆H₇ClFN₃

Purity: Min. 95%

Molecular weight: 175.59 g/mol

Ref: 3D-EXB36217