CAS 1179362-50-5

2-Pyridinecarboximidamide, 5-phenyl-, hydrochloride (1:1)

Description:

2-Pyridinecarboximidamide, 5-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboximidamide functional group, which contributes to its potential as a biological or pharmaceutical agent. The presence of the phenyl group enhances its aromatic properties and may influence its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including drug formulation. The compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its molecular interactions, stability, and potential applications in synthesis or as a therapeutic agent would depend on its structural characteristics and the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₂H₁₁N₃·ClH

InChI: InChI=1S/C12H11N3.ClH/c13-12(14)11-7-6-10(8-15-11)9-4-2-1-3-5-9;/h1-8H,(H3,13,14);1H

InChI key: InChIKey=BXHJWKSDJAZAGU-UHFFFAOYSA-N

SMILES: C(=N)(N)C=1C=CC(=CN1)C2=CC=CC=C2.Cl

Synonyms:

• 2-Pyridinecarboximidamide, 5-phenyl-, hydrochloride (1:1)

5-Phenylpicolinimidamide hydrochloride

CAS: 1179362-50-5

Formula: C₁₂H₁₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 233.6968

Ref: IN-DA008ZZP

5-Phenylpicolinimidamide hydrochloride

CAS: 1179362-50-5

5-Phenylpicolinimidamide hydrochloride

Purity: 95%

Molecular weight: 233.7g/mol

Ref: 54-OR1044947

5-Phenylpicolinimidamide hydrochloride

CAS: 1179362-50-5

Formula: C₁₂H₁₂ClN₃

Purity: 95%

Molecular weight: 233.7

Ref: 10-F327862