
CAS 117947-29-2
:4-Fluoro-2-methyl-N-(1-methylethyl)benzenamine
Description:
4-Fluoro-2-methyl-N-(1-methylethyl)benzenamine, with the CAS number 117947-29-2, is an organic compound characterized by its aromatic amine structure. It features a fluorine atom and a methyl group attached to a benzene ring, along with an isopropyl group linked to the nitrogen atom. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate solubility in organic solvents and is less soluble in water due to its hydrophobic aromatic structure. The presence of the fluorine atom can influence its reactivity and polarity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the amine functional group can participate in hydrogen bonding, affecting its physical properties and reactivity. Safety considerations should be taken into account, as aromatic amines can be toxic and potentially carcinogenic. Proper handling and storage in a controlled environment are essential to mitigate any health risks associated with this compound.
Formula:C10H14FN
InChI:InChI=1S/C10H14FN/c1-7(2)12-10-5-4-9(11)6-8(10)3/h4-7,12H,1-3H3
InChI key:InChIKey=XVQHVNWXTDOLQR-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=C(C)C=C(F)C=C1
Synonyms:- 4-Fluoro-2-methyl-N-(1-methylethyl)benzenamine
- Benzenamine, 4-fluoro-2-methyl-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.