CAS 1179533-41-5
:3-(Trifluoromethyl)-2-pyridinecarboximidamide
Description:
3-(Trifluoromethyl)-2-pyridinecarboximidamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a trifluoromethyl group and an amidine functional group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The amidine moiety contributes to its basicity and can participate in hydrogen bonding, making it a versatile compound in various chemical reactions. This substance may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and solubility characteristics are influenced by the presence of the trifluoromethyl group, which can also affect its environmental persistence. Overall, 3-(Trifluoromethyl)-2-pyridinecarboximidamide is a compound of interest in both synthetic and medicinal chemistry due to its distinctive functional groups and potential applications.
Formula:C7H6F3N3
InChI:InChI=1S/C7H6F3N3/c8-7(9,10)4-2-1-3-13-5(4)6(11)12/h1-3H,(H3,11,12)
InChI key:InChIKey=HCXKNFZGDIYIBO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C(=N)N)N=CC=C1
Synonyms:- 3-(Trifluoromethyl)-2-pyridinecarboximidamide
- 2-Pyridinecarboximidamide, 3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
