
CAS 1179533-42-6
:6-Methoxy-2-pyridinecarboximidamide
Description:
6-Methoxy-2-pyridinecarboximidamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 6-position of the pyridine enhances its solubility and reactivity. The carboximidamide functional group (-C(=NH)NH2) at the 2-position contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential hydrogen bonding capabilities, which could influence its interactions with biological targets. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be affected by the presence of the methoxy and carboximidamide groups. As with many organic compounds, the specific characteristics, including melting point, boiling point, and spectral data, would need to be determined experimentally or sourced from reliable databases for precise applications in research or industry.
Formula:C7H9N3O
InChI:InChI=1S/C7H9N3O/c1-11-6-4-2-3-5(10-6)7(8)9/h2-4H,1H3,(H3,8,9)
InChI key:InChIKey=BYLMMYUJLGSLAJ-UHFFFAOYSA-N
SMILES:C(=N)(N)C=1N=C(OC)C=CC1
Synonyms:- 2-Pyridinecarboximidamide, 6-methoxy-
- 6-Methoxy-2-pyridinecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.