CAS 1179533-74-4

4-Fluoro-2-pyridinecarboximidamide

Description:

4-Fluoro-2-pyridinecarboximidamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 4-position of the pyridine ring and a carboximidamide functional group contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboximidamide group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications to the pyridine ring can influence biological activity. Additionally, the fluorine substituent may enhance lipophilicity and metabolic stability. As with many nitrogen-containing heterocycles, it may also exhibit interesting reactivity patterns, making it a subject of interest in synthetic organic chemistry. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₆H₆FN₃

InChI: InChI=1S/C6H6FN3/c7-4-1-2-10-5(3-4)6(8)9/h1-3H,(H3,8,9)

InChI key: InChIKey=OKHRQYGHSZLOPG-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC(F)=CC=N1

Synonyms:

• 4-Fluoro-2-pyridinecarboximidamide
• 2-Pyridinecarboximidamide, 4-fluoro-