
CAS 117961-24-7
:L-Tyrosyl-L-tyrosyl-L-leucine
Description:
L-Tyrosyl-L-tyrosyl-L-leucine, identified by its CAS number 117961-24-7, is a synthetic peptide composed of two tyrosine residues and one leucine residue. This compound is characterized by its specific amino acid sequence, which influences its biochemical properties and potential biological activities. Peptides like L-Tyrosyl-L-tyrosyl-L-leucine often exhibit unique solubility profiles, stability under various pH conditions, and the ability to interact with biological receptors or enzymes. The presence of tyrosine, an aromatic amino acid, may contribute to its potential antioxidant properties, while leucine, known for its role in protein synthesis and muscle metabolism, may enhance its biological relevance. Such peptides are of interest in pharmaceutical and biotechnological applications, including drug development and as potential therapeutic agents. However, detailed studies on its specific biological activities, pharmacokinetics, and toxicity are essential for understanding its full potential and safety profile in clinical settings.
Formula:C24H31N3O6
InChI:InChI=1S/C24H31N3O6/c1-14(2)11-21(24(32)33)27-23(31)20(13-16-5-9-18(29)10-6-16)26-22(30)19(25)12-15-3-7-17(28)8-4-15/h3-10,14,19-21,28-29H,11-13,25H2,1-2H3,(H,26,30)(H,27,31)(H,32,33)/t19-,20-,21-/m0/s1
InChI key:InChIKey=HZDQUVQEVVYDDA-ACRUOGEOSA-N
SMILES:[C@H](CC1=CC=C(O)C=C1)(C(N[C@@H](CC(C)C)C(O)=O)=O)NC([C@H](CC2=CC=C(O)C=C2)N)=O
Synonyms:- L-Tyrosyl-L-tyrosyl-L-leucine
- L-Leucine, N-(N-L-tyrosyl-L-tyrosyl)-
- 176: PN: WO2009077864 SEQID: 192 claimed protein
- L-Leucine, L-tyrosyl-L-tyrosyl-
- 176: PN: EP2071334 SEQID: 192 claimed protein
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
