CAS 117977-20-5
:2-(Chloromethyl)-4-(3-methoxypropoxy)-3-methylpyridine
Description:
2-(Chloromethyl)-4-(3-methoxypropoxy)-3-methylpyridine, with the CAS number 117977-20-5, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a chloromethyl group, which enhances its reactivity, and a methoxypropoxy substituent that contributes to its solubility and potential interactions in various chemical environments. The presence of the methyl group on the pyridine ring can influence its electronic properties and steric hindrance. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules. Additionally, the presence of functional groups such as the chloromethyl and methoxypropoxy moieties may allow for further derivatization, expanding its utility in various chemical reactions. Safety and handling precautions should be observed due to the presence of the chloromethyl group, which can be reactive and potentially hazardous.
Formula:C11H16ClNO2
InChI:InChI=1S/C11H16ClNO2/c1-9-10(8-12)13-5-4-11(9)15-7-3-6-14-2/h4-5H,3,6-8H2,1-2H3
InChI key:InChIKey=XPYNCLYLFSMFQE-UHFFFAOYSA-N
SMILES:O(CCCOC)C=1C(C)=C(CCl)N=CC1
Synonyms:- 2-(Chloromethyl)-4-(3-Methoxypropoxy)-3-Methylpyridine
- 2-Chloeomethoxy-4-(3-Methoxy Propoxy)-3-Methyl Pyridine
- 2-Chloromethoxy-4-(3-Methoxy Propoxy)-3-Methyl Pyridine
- 2-Chloromethyl-3-Methyl-4-(3-Methoxypropoxy)-Pyridine
- 2-Chloromethyl-3-Methyl-4-Methoxypropoxy Pyridine
- 2-Chloromethyl-4-(3-methoxypropyloxy)-3-methylpyridine
- 4-(3-Methoxypropoxy)-3-Methyl-2-Chloromethylpyridine
- 4-[3-MethoxyPropoxy]-3-Methyl-2-ChloromethylPyridineHcl
- Pyridine, 2-(chloromethyl)-4-(3-methoxypropoxy)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Chloromethyl)-4-(3-methoxypropoxy)-3-methylpyridine
CAS:Formula:C11H16ClNO2Molecular weight:229.7032
