
CAS 118-02-5
:2,4-Dinitrosoresorcinol
Description:
2,4-Dinitrosoresorcinol, with the CAS number 118-02-5, is an organic compound characterized by its distinctive chemical structure, which includes two nitroso groups (-NO) attached to a resorcinol backbone. This compound typically appears as a yellow to orange crystalline solid and is known for its strong oxidizing properties. It is soluble in organic solvents but has limited solubility in water. 2,4-Dinitrosoresorcinol is often utilized in analytical chemistry, particularly in the detection of phenolic compounds and as a reagent in various chemical reactions. Its ability to form colored complexes with certain metal ions makes it valuable in colorimetric assays. Additionally, it exhibits potential applications in the field of materials science and as a precursor for synthesizing other chemical compounds. However, due to its reactive nature, handling this substance requires caution, as it can pose health risks if ingested or inhaled. Proper safety protocols should be followed when working with 2,4-Dinitrosoresorcinol in laboratory settings.
Formula:C6H4N2O4
InChI:InChI=1S/C6H4N2O4/c9-4-2-1-3(7-11)6(10)5(4)8-12/h1-2,9-10H
InChI key:InChIKey=IBZJGOGLCABLDJ-UHFFFAOYSA-N
SMILES:N(=O)C1=C(O)C(N=O)=CC=C1O
Synonyms:- 2,4-Dinitrosoresorcinol
- Resorcinol, 2,4-dinitroso-
- 2,4-Dinitroso-1,3-benzenediol
- Rezad 33
- 1,3-Benzenediol, 2,4-dinitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.