CAS 118-36-5

2-Hydroxy-3-dibenzofurancarboxylic acid

Description:

2-Hydroxy-3-dibenzofurancarboxylic acid, with the CAS number 118-36-5, is an organic compound characterized by its unique structure, which includes a dibenzofuran moiety and a carboxylic acid functional group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the dibenzofuran structure may impart specific electronic and optical properties. It is often studied for its reactivity and potential as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many organic acids, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 2-Hydroxy-3-dibenzofurancarboxylic acid is a compound of interest due to its structural features and potential utility in various chemical applications.

Formula: C₁₃H₈O₄

InChI: InChI=1S/C13H8O4/c14-10-5-8-7-3-1-2-4-11(7)17-12(8)6-9(10)13(15)16/h1-6,14H,(H,15,16)

InChI key: InChIKey=QWRCZQZZFQIUEF-UHFFFAOYSA-N

SMILES: OC=1C=C2C=3C(OC2=CC1C(O)=O)=CC=CC3

Synonyms:

• 2-Hydroxy-3-dibenzofurancarboxylic acid
• 2-Hydroxy-3-carboxydibenzofuran
• NSC 60577
• 3-Dibenzofurancarboxylic acid, 2-hydroxy-
• 2-Hydroxydibenzo[b,d]furan-3-carboxylic acid

3-Dibenzofurancarboxylic acid, 2-hydroxy-

CAS: 118-36-5

Formula: C₁₃H₈O₄

Molecular weight: 228.2002

Ref: IN-DA000IA9