CAS 118-45-6
:4-Chlorophthalic anhydride
Description:
4-Chlorophthalic anhydride is an organic compound characterized by its anhydride functional group and a chlorinated aromatic structure. It is a white to light yellow crystalline solid at room temperature, exhibiting a melting point that typically falls within a moderate range. This compound is known for its reactivity, particularly in electrophilic aromatic substitution reactions due to the presence of the electron-withdrawing chlorine atom, which enhances its electrophilic character. 4-Chlorophthalic anhydride is primarily used in the synthesis of various chemical intermediates, including dyes, pigments, and pharmaceuticals. It also serves as a key building block in the production of polyesters and other polymers. The compound is soluble in organic solvents such as acetone and chloroform but is generally insoluble in water. Safety precautions are essential when handling this substance, as it can be irritating to the skin, eyes, and respiratory system. Proper storage in a cool, dry place away from incompatible materials is recommended to maintain its stability and prevent degradation.
Formula:C8H3ClO3
InChI:InChI=1S/C8H3ClO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H
InChI key:InChIKey=BTTRMCQEPDPCPA-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)O1)=CC=C(Cl)C2
Synonyms:- 1,3-Isobenzofurandione, 5-chloro-
- 4-Chlorophthalic acid anhydride
- 5-Chloro-1,3-isobenzofurandione
- 5-Chloro-2-Benzofuran-1,3-Dione
- 5-Chloroisobenzofuran-1,3-dione
- Chlorophtalicanhydre
- Phthalic anhydride, 4-chloro-
- p-Chlorophthalic anhydride
- 4-Chlorophthalic anhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Chlorophthalic Anhydride
CAS:Formula:C8H3ClO3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to lumpMolecular weight:182.565-Chloroisobenzofuran-1,3-dione
CAS:Formula:C8H3ClO3Purity:97%Color and Shape:SolidMolecular weight:182.56064-Chlorophthalic anhydride
CAS:<p>4-Chlorophthalic anhydride</p>Purity:98%Molecular weight:182.56g/mol4-Chlorophthalic anhydride
CAS:Formula:C8H3ClO3Purity:97%Color and Shape:Solid, White solidMolecular weight:182.564-Chlorophthalic anhydride
CAS:<p>4-Chlorophthalic anhydride is a colorless crystalline solid that is soluble in acetone and ethanol. It is used to synthesize dyes, paints, varnishes, and other organic compounds. This compound can be produced by the reaction of copper chloride with chloral hydrate or by the dehydration of phthalic anhydride with concentrated sulfuric acid. 4-Chlorophthalic anhydride reacts with hydrogen chloride to form 4-chlorophthalic acid. The solubility of this compound in water varies depending on the temperature and pH levels. The solubilities of 4-chlorophthalic anhydride are determined using experimental solubility data and calculated using thermodynamic values and vibrational frequencies. Phase equilibrium studies show that at low temperatures, 4-chlorophthalic anhydride is more soluble in water than at higher temperatures due to its lower energy state.</p>Formula:C8H3ClO3Purity:Min. 95%Molecular weight:182.56 g/mol





