CAS 118-62-7
:2-Hydroxy-N-2-propen-1-ylbenzamide
Description:
2-Hydroxy-N-2-propen-1-ylbenzamide, also known as salicylamide, is an organic compound characterized by its amide functional group and a hydroxyl group attached to a benzene ring. This compound typically appears as a white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of the hydroxyl group. The structure features a propenyl group, which contributes to its reactivity and potential applications in organic synthesis. Salicylamide is known for its analgesic and anti-inflammatory properties, making it relevant in medicinal chemistry. It can participate in various chemical reactions, including acylation and alkylation, due to the presence of both the amide and hydroxyl functionalities. Additionally, it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with biological systems. Overall, 2-Hydroxy-N-2-propen-1-ylbenzamide is a versatile compound with significant implications in both industrial and pharmaceutical contexts.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c1-2-7-11-10(13)8-5-3-4-6-9(8)12/h2-6,12H,1,7H2,(H,11,13)
InChI key:InChIKey=IECWHJOALGVHPA-UHFFFAOYSA-N
SMILES:C(NCC=C)(=O)C1=C(O)C=CC=C1
Synonyms:- 2-Hydroxy-N-2-propen-1-ylbenzamide
- 2-Hydroxy-N-prop-2-enylbenzamide
- 2-hydroxy-N-(prop-2-en-1-yl)benzamide
- Benzamide, 2-hydroxy-N-2-propen-1-yl-
- Benzamide, 2-hydroxy-N-2-propenyl-
- NSC 158443
- Salicylamide, N-allyl-
- N-Allylsalicylamide
- 2-Hydroxy-N-(2-propenyl)benzamide
- N-Allyl-2-hydroxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Allyl-2-hydroxybenzamide
CAS:Controlled ProductFormula:C10H11NO2Color and Shape:NeatMolecular weight:177.2
