
CAS 118-98-9
:5-Diazo-6-oxo-1,3-cyclohexadiene-1-carboxylic acid
Description:
5-Diazo-6-oxo-1,3-cyclohexadiene-1-carboxylic acid, with the CAS number 118-98-9, is a chemical compound characterized by its diazo and carboxylic acid functional groups. This compound typically appears as a solid and is known for its reactivity, particularly in organic synthesis. The presence of the diazo group imparts unique properties, making it useful in various chemical reactions, including coupling reactions and as a precursor for the synthesis of other organic compounds. The cyclohexadiene structure contributes to its stability and reactivity, allowing for potential applications in dye chemistry and as an intermediate in the synthesis of pharmaceuticals. Additionally, the compound's oxo group enhances its electrophilic character, facilitating further chemical transformations. Safety considerations should be taken into account when handling this compound, as diazo compounds can be sensitive and potentially hazardous. Overall, 5-Diazo-6-oxo-1,3-cyclohexadiene-1-carboxylic acid is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C7H4N2O3
InChI:InChI=1S/C7H4N2O3/c8-9-5-3-1-2-4(6(5)10)7(11)12/h1-3H,(H,11,12)
InChI key:InChIKey=DIKNVVZEYKJQIT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=O)C(=[N+]=[N-])C=CC1
Synonyms:- 5-Diazo-6-oxo-1,3-cyclohexadiene-1-carboxylic acid
- 1,3-Cyclohexadiene-1-carboxylic acid, 5-diazo-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.