CymitQuimica logo

CAS 118000-40-1

:

2-(chloromethyl)-6-methylimidazo[1,2-a]pyridine

Description:
2-(Chloromethyl)-6-methylimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates both nitrogen and carbon atoms in its ring system. This compound features a chloromethyl group, which enhances its reactivity, making it a potential intermediate in organic synthesis. The presence of the methyl group at the 6-position contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The imidazo[1,2-a]pyridine framework is known for its biological activity, including potential mutagenic properties, which have been studied in the context of food chemistry and carcinogenicity. As a chemical entity, it may exhibit various physical properties such as melting point, boiling point, and spectral characteristics, which are essential for its identification and application in research. Safety data should be considered due to its potential reactivity and biological implications, necessitating proper handling and storage protocols in laboratory settings.
Formula:C9H9ClN2
InChI:InChI=1/C9H9ClN2/c1-7-2-3-9-11-8(4-10)6-12(9)5-7/h2-3,5-6H,4H2,1H3
SMILES:Cc1ccc2nc(CCl)cn2c1
Synonyms:
  • Imidazo[1,2-A]Pyridine, 2-(Chloromethyl)-6-Methyl-
  • 2-(Chloromethyl)-6-Methyl-Imidazo[1,2-A]Pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.