CAS 118000-43-4

IMIDAZO[1,2-A]PYRIDINE-2-CARBALDEHYDE

Description:

Imidazo[1,2-a]pyridine-2-carbaldehyde is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features an aldehyde functional group (-CHO) at the 2-position of the pyridine ring, making it reactive and useful in various synthetic applications. It typically appears as a solid or liquid, depending on the specific conditions, and is soluble in polar organic solvents. The presence of both nitrogen atoms in the ring structure enhances its potential for coordination with metal ions, making it of interest in coordination chemistry and catalysis. Additionally, imidazo[1,2-a]pyridine derivatives are known for their biological activity, including antimicrobial and anticancer properties, which may extend to this compound. Its reactivity and structural features make it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₆N₂O

InChI: InChI=1/C8H6N2O/c11-6-7-5-10-4-2-1-3-8(10)9-7/h1-6H

SMILES: c1ccn2cc(C=O)nc2c1

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxaldehyde (9CI)
• 2-Formylpyridoimidazole

Imidazo[1,2-a]pyridine-2-carbaldehyde

CAS: 118000-43-4

Formula: C₈H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 146.1460

Ref: IN-DA0081CO

Imidazo[1,2-a]pyridine-2-carbaldehyde

CAS: 118000-43-4

Imidazo[1,2-a]pyridine-2-carbaldehyde

Purity: 95%

Molecular weight: 146.15g/mol

Ref: 54-OR318013

2-Formylpyridoimidazole

CAS: 118000-43-4

Formula: C₈H₆N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 146.149

Ref: 10-F046410