
CAS 118000-48-9
:4-Imidazo[1,2-a]pyridin-2-ylbenzaldehyde
Description:
4-Imidazo[1,2-a]pyridin-2-ylbenzaldehyde is a heterocyclic organic compound characterized by the presence of both imidazole and pyridine rings fused to a benzaldehyde moiety. This compound features a complex structure that contributes to its potential biological activity and applications in medicinal chemistry. It typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of reactivity due to the presence of the aldehyde functional group, which can participate in nucleophilic addition reactions. The imidazo and pyridine rings can influence the compound's electronic properties, making it a candidate for interactions with biological targets, such as enzymes or receptors. Additionally, its unique structure may impart specific pharmacological activities, which are of interest in drug discovery and development. As with many heterocyclic compounds, the synthesis and characterization of 4-Imidazo[1,2-a]pyridin-2-ylbenzaldehyde are crucial for understanding its potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H10N2O
InChI:InChI=1S/C14H10N2O/c17-10-11-4-6-12(7-5-11)13-9-16-8-2-1-3-14(16)15-13/h1-10H
InChI key:InChIKey=MEDHSOWGQJBYSH-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=C(C2=CN3C(=N2)C=CC=C3)C=C1
Synonyms:- 4-(Imidazo[1,2-a]pyridin-2-yl)benzaldehyde
- 4-Imidazo[1,2-a]pyridin-2-ylbenzaldehyde
- Benzaldehyde, 4-imidazo[1,2-a]pyridin-2-yl-
- Imidazo[1,2-a]pyridine, benzaldehyde deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.