CAS 118001-68-6

4-Imidazo[2,1-b]thiazol-6-ylbenzaldehyde

Description:

4-Imidazo[2,1-b]thiazol-6-ylbenzaldehyde is a heterocyclic organic compound characterized by the presence of both imidazole and thiazole rings fused to a benzaldehyde moiety. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activities, making it of interest in medicinal chemistry and drug development. The imidazole and thiazole rings contribute to its ability to interact with biological targets, often influencing its pharmacological properties. The presence of the aldehyde functional group allows for further chemical reactivity, enabling the compound to participate in various chemical reactions, such as condensation and nucleophilic addition. Additionally, its solubility characteristics can vary depending on the solvent, which is an important factor for its application in biological systems. Overall, 4-Imidazo[2,1-b]thiazol-6-ylbenzaldehyde is a versatile compound with significant implications in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₂H₈N₂OS

InChI: InChI=1S/C12H8N2OS/c15-8-9-1-3-10(4-2-9)11-7-14-5-6-16-12(14)13-11/h1-8H

InChI key: InChIKey=CREFTZDQROCPJJ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC=C(C2=CN3C(=N2)SC=C3)C=C1

Synonyms:

• Imidazo[2,1-b]thiazole, benzaldehyde deriv.
• Benzaldehyde, 4-imidazo[2,1-b]thiazol-6-yl-
• 4-(Imidazo[2,1-b]thiazol-6-yl)benzaldehyde
• 4-Imidazo[2,1-b]thiazol-6-ylbenzaldehyde
• 6-(4-Formylphenyl)imidazo[2,1-b]thiazole