CAS 118001-74-4: 4-(4-Thiazolylmethoxy)benzaldehyde

Description:4-(4-Thiazolylmethoxy)benzaldehyde is an organic compound characterized by its thiazole and benzaldehyde functional groups. It features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, linked to a benzaldehyde moiety through a methoxy group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the aldehyde functional group suggests that it can participate in various chemical reactions, including oxidation and condensation reactions. Additionally, the thiazole ring may contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula:C₁₁H₉NO₂S

InChI:InChI=1S/C11H9NO2S/c13-5-9-1-3-11(4-2-9)14-6-10-7-15-8-12-10/h1-5,7-8H,6H2

InChI key:InChIKey=LTBNVXWZLUHELL-UHFFFAOYSA-N

SMILES:O=CC1=CC=C(OCC=2N=CSC2)C=C1

Synonyms:
4-(4-Thiazolylmethoxy)benzaldehyde
Benzaldehyde, 4-(4-thiazolylmethoxy)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Benzaldehyde, 4-(4-thiazolylmethoxy)- REF: IN-DA00HECWCAS: 118001-74-4	- - -	To inquire	Tue 04 Mar 25
4-(1,3-Thiazol-4-ylmethoxy)benzaldehyde REF: 10-F640021CAS: 118001-74-4	95+%	- - -	Discontinued product
4-(1,3-Thiazol-4-ylmethoxy)benzaldehyde REF: 3D-TEA00174CAS: 118001-74-4	Min. 95%	- - -	Discontinued product