
CAS 1180016-75-4
:Benzamide, 3-bromo-5-(cyclopropylmethoxy)-N-methoxy-N-methyl-
Description:
Benzamide, 3-bromo-5-(cyclopropylmethoxy)-N-methoxy-N-methyl- is an organic compound characterized by its benzamide structure, which features a benzene ring attached to a carbonyl group (C=O) and an amine (NH) group. The presence of a bromine atom at the 3-position and a cyclopropylmethoxy group at the 5-position introduces unique steric and electronic properties, potentially influencing its reactivity and interactions. The N-methoxy and N-methyl substituents on the amine nitrogen enhance the compound's lipophilicity and may affect its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which it is studied. Safety data and handling precautions should be considered due to the presence of bromine, which can be hazardous.
Formula:C13H16BrNO3
InChI:InChI=1S/C13H16BrNO3/c1-15(17-2)13(16)10-5-11(14)7-12(6-10)18-8-9-3-4-9/h5-7,9H,3-4,8H2,1-2H3
InChI key:InChIKey=GMIYLBBUXRPWNG-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C1=CC(OCC2CC2)=CC(Br)=C1
Synonyms:- Benzamide, 3-bromo-5-(cyclopropylmethoxy)-N-methoxy-N-methyl-
- 3-Bromo-5-cyclopropylmethoxy-n-methoxy-n-methyl-benzamide
- 3-Bromo-5-cyclopropylmethoxy-N-methoxy-N-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.