CAS 1180112-42-8

1,7-Diazaspiro[3.5]nonane-7-carboxylic acid, 1,1-dimethylethyl ester, ethanedioate (1:1)

Description:

1,7-Diazaspiro[3.5]nonane-7-carboxylic acid, 1,1-dimethylethyl ester, ethanedioate (1:1), identified by CAS number 1180112-42-8, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylic acid functional group. This compound features a diazaspiro framework, indicating the presence of two nitrogen atoms within a spirocyclic arrangement, contributing to its potential biological activity and interaction with various biological systems. The presence of the tert-butyl ester group enhances its lipophilicity, which may influence its solubility and permeability in biological membranes. The ethanedioate component suggests the presence of a dicarboxylate moiety, which can participate in various chemical reactions and may play a role in the compound's reactivity and stability. Overall, this compound's structural characteristics may render it of interest in medicinal chemistry and materials science, although specific applications and biological activities would require further investigation and characterization.

Formula: C₁₂H₂₂N₂O₂·C₂H₂O₄

InChI: InChI=1S/C12H22N2O2.C2H2O4/c1-11(2,3)16-10(15)14-8-5-12(6-9-14)4-7-13-12;3-1(4)2(5)6/h13H,4-9H2,1-3H3;(H,3,4)(H,5,6)

InChI key: InChIKey=HLBLCLWSYNFUSK-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC2(CC1)CCN2.C(C(O)=O)(O)=O

Synonyms:

• 1,7-Diazaspiro[3.5]nonane-7-carboxylic acid, 1,1-dimethylethyl ester, ethanedioate (1:1)

1,7-Diazaspiro[3.5]nonane-7-carboxylic acid, 1,1-dimethylethyl ester, ethanedioate (1:1)

CAS: 1180112-42-8

Formula: C₁₄H₂₄N₂O₆

Purity: 95%

Molecular weight: 316.3502

Ref: IN-DA000IBF

7-Boc-1,7-diaza-spiro[3.5]nonane oxalate

CAS: 1180112-42-8

7-Boc-1,7-diaza-spiro[3.5]nonane oxalate

Molecular weight: 316.35g/mol

Ref: 54-OR317210