CAS 118024-26-3: blumeatin
Description:Blumeatin, with the CAS number 118024-26-3, is a chemical compound that belongs to the class of natural products derived from plants. It is primarily known for its presence in certain species of the genus Blumea, which are often used in traditional medicine. The compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Blumeatin's structure features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique chemical behavior and interactions. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in medicinal chemistry. As research continues, the full spectrum of its therapeutic potential and mechanisms of action is being explored, highlighting the importance of natural compounds in drug discovery and development.
Formula:C16H14O6
InChI:InChI=1S/C16H14O6/c1-21-11-5-12(19)16-13(20)7-14(22-15(16)6-11)8-2-9(17)4-10(18)3-8/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1
InChI key:InChIKey=YEYLMQKEGSQNGZ-AWEZNQCLSA-N
SMILES:O=C1C2=C(O)C=C(OC)C=C2OC(C=3C=C(O)C=C(O)C3)C1