CAS 118024-43-4
:N-Benzoyl-O,a-dimethyl-DL-tyrosine
Description:
N-Benzoyl-O,α-dimethyl-DL-tyrosine, identified by its CAS number 118024-43-4, is a synthetic derivative of the amino acid tyrosine. This compound features a benzoyl group attached to the nitrogen of the amino group, along with two methyl groups on the alpha carbon, which contributes to its unique properties. It is characterized by its potential use in biochemical research and pharmaceutical applications, particularly in the study of protein interactions and enzyme activity. The presence of the benzoyl moiety enhances its lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the dimethyl substitution can affect its steric properties and reactivity. As a DL-isomer, it contains both D- and L-forms, which may exhibit different biological activities. Overall, N-Benzoyl-O,α-dimethyl-DL-tyrosine serves as an important compound in the field of medicinal chemistry and biochemistry, providing insights into the structure-activity relationships of tyrosine derivatives.
Formula:C19H20O4
InChI:InChI=1/C19H20O4/c1-19(18(21)22,12-14-8-10-16(23-2)11-9-14)13-17(20)15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3,(H,21,22)
SMILES:CC(Cc1ccc(cc1)OC)(CC(=O)c1ccccc1)C(=O)O
Synonyms:- N-Benzoyl-O,a-dimethyltyrosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
