CAS 118035-05-5
:(9Z)-2-hydroxy-6,10-dimethyl-4-(1-methylethyl)-1-methylidene-1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-5,12-epoxybenzo[10]annulen-6-yl butanoate
Description:
The chemical substance known as (9Z)-2-hydroxy-6,10-dimethyl-4-(1-methylethyl)-1-methylidene-1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-5,12-epoxybenzo[10]annulen-6-yl butanoate, with the CAS number 118035-05-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and stereocenters. This compound features a dodecahydrobenzo[10]annulene core, indicating a polycyclic structure that contributes to its unique chemical properties. The presence of a hydroxyl group (-OH) and an epoxy group (-O-) suggests potential reactivity, particularly in forming hydrogen bonds and participating in nucleophilic reactions. Additionally, the butanoate moiety indicates that it may exhibit ester-like characteristics, influencing its solubility and reactivity in various solvents. The stereochemistry, particularly the (9Z) configuration, implies specific spatial arrangements that can affect the compound's biological activity and interactions with other molecules. Overall, this substance is of interest in fields such as organic synthesis, medicinal chemistry, and materials science due to its structural complexity and potential applications.
Formula:C24H38O4
InChI:InChI=1/C24H38O4/c1-7-9-20(26)28-24(6)11-8-10-15(4)12-19-21-16(5)18(25)13-17(14(2)3)22(21)23(24)27-19/h10,14,17-19,21-23,25H,5,7-9,11-13H2,1-4,6H3/b15-10-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Litophynin C
CAS:<p>Litophynin C is an Insect Growth Inhibitory Diterpenoid from a Soft Coral Litophyton sp.</p>Formula:C24H38O4Color and Shape:SolidMolecular weight:390.56
