
CAS 1180497-44-2
:7-Bromo-6-methoxy-1H-indole-2,3-dione
Description:
7-Bromo-6-methoxy-1H-indole-2,3-dione, with the CAS number 1180497-44-2, is a synthetic organic compound belonging to the indole family. This compound features a bromine atom and a methoxy group attached to the indole structure, which contributes to its unique chemical properties. It is characterized by its indole core, which is a bicyclic structure consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of the bromine atom typically enhances the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitutions. The methoxy group can influence the compound's solubility and polarity, affecting its interactions in biological systems. 7-Bromo-6-methoxy-1H-indole-2,3-dione may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific applications and biological effects would depend on further studies and research, which could explore its potential as a therapeutic agent or its role in biochemical pathways.
Formula:C9H6BrNO3
InChI:InChI=1S/C9H6BrNO3/c1-14-5-3-2-4-7(6(5)10)11-9(13)8(4)12/h2-3H,1H3,(H,11,12,13)
InChI key:InChIKey=KWVAKRDVVDAPRQ-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(=O)C(=O)N2)=CC=C1OC
Synonyms:- 1H-Indole-2,3-dione, 7-bromo-6-methoxy-
- 7-Bromo-6-methoxy-1H-indole-2,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.