CAS 1180497-46-4

2-Amino-5-methoxy-3-methylbenzoic acid

Description:

2-Amino-5-methoxy-3-methylbenzoic acid, identified by its CAS number 1180497-46-4, is an organic compound characterized by the presence of an amino group (-NH2), a methoxy group (-OCH3), and a carboxylic acid group (-COOH) attached to a benzene ring. This compound features a methyl group (-CH3) at the 3-position and a methoxy group at the 5-position relative to the amino group, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid and amino functionalities. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with biological systems, and it may participate in various chemical reactions typical of amino acids and aromatic compounds. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-5-3-6(13-2)4-7(8(5)10)9(11)12/h3-4H,10H2,1-2H3,(H,11,12)

InChI key: InChIKey=XXPURUMOXCPQJB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N)C(C)=CC(OC)=C1

Synonyms:

• Benzoic acid, 2-amino-5-methoxy-3-methyl-
• 2-Amino-5-methoxy-3-methylbenzoic acid

2-Amino-5-methoxy-3-methylbenzoic acid

CAS: 1180497-46-4

Versatile small molecule scaffold

Formula: C₉H₁₁NO₃

Purity: Min. 95%

Molecular weight: 181.19 g/mol

Ref: 3D-FXB49746