CAS 118055-04-2

Pyrazolo[1,5-a]pyridine-3-ethanamine

Description:

Pyrazolo[1,5-a]pyridine-3-ethanamine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrazole ring fused to a pyridine ring. This compound features an ethylamine side chain at the 3-position of the pyrazole moiety, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with various biological targets. Its structure allows for the possibility of forming hydrogen bonds, which can enhance its binding affinity to biological receptors. Additionally, the presence of nitrogen atoms in the rings may influence its electronic properties and reactivity. As with many organic compounds, safety data should be consulted for handling and storage, as well as any potential toxicity or environmental impact associated with its use.

Formula: C₉H₁₁N₃

InChI: InChI=1S/C9H11N3/c10-5-4-8-7-11-12-6-2-1-3-9(8)12/h1-3,6-7H,4-5,10H2

InChI key: InChIKey=KDEZORYKYHTRFD-UHFFFAOYSA-N

SMILES: C(CN)C1=C2N(N=C1)C=CC=C2

Synonyms:

• Pyrazolo[1,5-a]pyridine-3-ethanamine
• 2-[Pyrazolo[1,5-a]pyridin-3-yl]ethan-1-amine
• 2-(Pyrazolo[1,5-a]pyridin-3-yl)ethanamine