CAS 118078-66-3
:2-Fluoro-4-trifluoromethyl-pyridine
Description:
2-Fluoro-4-trifluoromethyl-pyridine is a heterocyclic aromatic compound characterized by the presence of a pyridine ring substituted with both a fluorine atom and a trifluoromethyl group. The molecular structure features a nitrogen atom within the six-membered ring, contributing to its basicity and potential reactivity. This compound is typically colorless to pale yellow in appearance and is known for its relatively low volatility and moderate solubility in organic solvents. The trifluoromethyl group significantly enhances the lipophilicity and electron-withdrawing properties of the molecule, which can influence its reactivity and interactions in various chemical processes. Due to these characteristics, 2-Fluoro-4-trifluoromethyl-pyridine is of interest in pharmaceutical and agrochemical research, where it may serve as a building block for the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C6H3F4N
InChI:InChI=1/C6H3F4N/c7-5-3-4(1-2-11-5)6(8,9)10/h1-3H
SMILES:c1cnc(cc1C(F)(F)F)F
Synonyms:- Pyridine, 2-Fluoro-4-(Trifluoromethyl)-
- 2-Fluoro-4-(trifluoromethyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-4-(trifluoromethyl)pyridine, 97%
CAS:2-Fluoro-4-(trifluoromethyl)pyridine acts as a reactant in the preparation of aminopyridines through amination reactions. It is also used as a catalytic ligand for regioselective preparation of tetramethylbiphenyls through aerobic oxidative coupling of xylene catalyzed by palladium. This Thermo SciFormula:C6H3F4NPurity:97%Color and Shape:Liquid, Clear colorlessMolecular weight:165.092-Fluoro-4-trifluoromethyl-pyridine
CAS:Formula:C6H3F4NPurity:95%Color and Shape:LiquidMolecular weight:165.08832-Fluoro-4-(trifluoromethyl)pyridine
CAS:2-Fluoro-4-(trifluoromethyl)pyridineFormula:C6H3F4NPurity:98%Color and Shape: clear. pale yellow liquidMolecular weight:165.09g/mol2-Fluoro-4-(trifluoromethyl)pyridine
CAS:Formula:C6H3F4NPurity:>98.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:165.092-Fluoro-4-(trifluoromethyl)pyridine
CAS:Formula:C6H3F4NPurity:95%Color and Shape:Liquid, ClearMolecular weight:165.091




