
CAS 118109-50-5
:6,7-Dimethoxy-4(3H)-quinazolinethione
Description:
6,7-Dimethoxy-4(3H)-quinazolinethione is a chemical compound characterized by its quinazoline core structure, which features a thione functional group. This compound typically exhibits a pale yellow to off-white crystalline appearance. The presence of two methoxy groups at the 6 and 7 positions contributes to its solubility in organic solvents and may influence its biological activity. Quinazolinethiones are known for their diverse pharmacological properties, including potential anti-cancer and anti-inflammatory activities. The thione group (–C=S) is significant in determining the reactivity and stability of the compound, often participating in various chemical reactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 6,7-Dimethoxy-4(3H)-quinazolinethione represents a class of compounds with potential applications in medicinal chemistry and drug development.
Formula:C10H10N2O2S
InChI:InChI=1S/C10H10N2O2S/c1-13-8-3-6-7(4-9(8)14-2)11-5-12-10(6)15/h3-5H,1-2H3,(H,11,12,15)
InChI key:InChIKey=QDKPQWRXXRKGAE-UHFFFAOYSA-N
SMILES:S=C1C=2C(=CC(OC)=C(OC)C2)NC=N1
Synonyms:- 6,7-Dimethoxy-4(3H)-quinazolinethione
- 4(3H)-Quinazolinethione, 6,7-dimethoxy-
- 4(1H)-Quinazolinethione, 6,7-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.