CymitQuimica logo

CAS 1181105-79-2

:

4-Ethyl-2-thiazoleacetic acid

Description:
4-Ethyl-2-thiazoleacetic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl group and a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. The presence of the thiazole moiety may impart biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure allows for potential interactions with biological targets, and it may exhibit properties such as antimicrobial or anti-inflammatory effects. As with many organic acids, it can participate in various chemical reactions, including esterification and amide formation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Ethyl-2-thiazoleacetic acid represents a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C7H9NO2S
InChI:InChI=1S/C7H9NO2S/c1-2-5-4-11-6(8-5)3-7(9)10/h4H,2-3H2,1H3,(H,9,10)
InChI key:InChIKey=SUWHRYGDJNZYJT-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=NC(CC)=CS1
Synonyms:
  • 2-Thiazoleacetic acid, 4-ethyl-
  • 4-Ethyl-2-thiazoleacetic acid
  • 2-(4-Ethyl-1,3-thiazol-2-yl)acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.