CAS 118121-89-4
:4-(5-fluoro-2-hydrazinylpyrimidin-4-yl)morpholine
Description:
4-(5-fluoro-2-hydrazinylpyrimidin-4-yl)morpholine, with the CAS number 118121-89-4, is a chemical compound characterized by its unique structural features, which include a morpholine ring and a pyrimidine moiety substituted with a hydrazine and a fluorine atom. This compound typically exhibits properties associated with both heterocyclic and nitrogen-containing compounds, making it of interest in medicinal chemistry and pharmaceutical research. The presence of the hydrazine group suggests potential reactivity, particularly in forming hydrazones or undergoing oxidation reactions. The fluorine atom can enhance the lipophilicity and metabolic stability of the compound, potentially influencing its biological activity. Additionally, the morpholine ring contributes to the compound's solubility and may affect its interaction with biological targets. Overall, this compound's characteristics make it a candidate for further investigation in drug development, particularly in the context of targeting specific biological pathways or diseases.
Formula:C8H12FN5O
InChI:InChI=1/C8H12FN5O/c9-6-5-11-8(13-10)12-7(6)14-1-3-15-4-2-14/h5H,1-4,10H2,(H,11,12,13)
SMILES:C1COCCN1c1c(cnc(n1)NN)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(5-Fluoro-2-hydrazinopyrimidin-4-yl)morpholine
CAS:Formula:C8H12FN5OPurity:%Molecular weight:213.21224-(5-Fluoro-2-hydrazinopyrimidin-4-yl)morpholine
CAS:4-(5-Fluoro-2-hydrazinopyrimidin-4-yl)morpholine
Molecular weight:213.21g/mol

