CymitQuimica logo

CAS 1181267-36-6

:

tert-butyl 4-(1-(2-ethoxyethyl)-1H-benzo[d]imidazol-2-yl)piperidine-1-carboxylate

Description:
Tert-butyl 4-(1-(2-ethoxyethyl)-1H-benzo[d]imidazol-2-yl)piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a benzo[d]imidazole moiety, and an ethoxyethyl substituent. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents due to its hydrophobic regions, while the ethoxy group may impart some degree of polarity. The presence of the tert-butyl group often contributes to steric hindrance, which can influence the compound's reactivity and interactions with biological targets. Additionally, the benzo[d]imidazole structure is known for its potential biological activity, making this compound of interest in medicinal chemistry. Its specific applications and behavior in various chemical environments would depend on factors such as pH, temperature, and the presence of other reactants. Overall, this compound represents a class of molecules that may have implications in drug development and pharmacology.
Formula:C21H31N3O3
InChI:InChI=1S/C21H31N3O3/c1-5-26-15-14-24-18-9-7-6-8-17(18)22-19(24)16-10-12-23(13-11-16)20(25)27-21(2,3)4/h6-9,16H,5,10-15H2,1-4H3
InChI key:WLBGIVZZFISEJL-UHFFFAOYSA-N
SMILES:CCOCCN1C2=CC=CC=C2N=C1C3CCN(CC3)C(=O)OC(C)(C)C
Synonyms:
  • Bilastine ITS-1
Found 7 products.