
CAS 1181267-37-7
:Methyl 4-[2-[4-(1H-benzimidazol-2-yl)-1-piperidinyl]ethyl]-α,α-dimethylbenzeneacetate
Description:
Methyl 4-[2-[4-(1H-benzimidazol-2-yl)-1-piperidinyl]ethyl]-α,α-dimethylbenzeneacetate, identified by its CAS number 1181267-37-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzimidazole moiety and a piperidine ring. This compound typically exhibits properties associated with its functional groups, such as potential pharmacological activity due to the presence of the benzimidazole, which is known for its role in various biological applications. The ester functional group in the molecule suggests it may have moderate solubility in organic solvents and could participate in hydrolysis reactions under certain conditions. Additionally, the presence of multiple aromatic rings may contribute to its stability and influence its interactions with biological targets. Overall, this compound's unique structure positions it as a candidate for research in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C25H31N3O2
InChI:InChI=1S/C25H31N3O2/c1-25(2,24(29)30-3)20-10-8-18(9-11-20)12-15-28-16-13-19(14-17-28)23-26-21-6-4-5-7-22(21)27-23/h4-11,19H,12-17H2,1-3H3,(H,26,27)
InChI key:InChIKey=QDVMKQMVBKTSSW-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(C(C(OC)=O)(C)C)C=C1)N2CCC(C=3NC=4C(N3)=CC=CC4)CC2
Synonyms:- Methyl 4-[2-[4-(1H-benzimidazol-2-yl)-1-piperidinyl]ethyl]-α,α-dimethylbenzeneacetate
- Benzeneacetic acid, 4-[2-[4-(1H-benzimidazol-2-yl)-1-piperidinyl]ethyl]-α,α-dimethyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
