CAS 118128-77-1

1,2,3,4-Tetrahydro-8-methyl-5-quinolinecarboxylic acid

Description:

1,2,3,4-Tetrahydro-8-methyl-5-quinolinecarboxylic acid is a bicyclic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and reactivity. The methyl group at the 8-position and the carboxylic acid functional group at the 5-position are significant for its chemical properties, influencing its solubility and potential interactions in biological systems. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may act as a ligand in coordination chemistry. Additionally, the compound's structural features may confer specific pharmacological activities, making it of interest in medicinal chemistry. Its CAS number, 118128-77-1, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1S/C11H13NO2/c1-7-4-5-9(11(13)14)8-3-2-6-12-10(7)8/h4-5,12H,2-3,6H2,1H3,(H,13,14)

InChI key: InChIKey=NRHUTOXLIVSHQM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=C(C)C=C1)NCCC2

Synonyms:

• 5-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-8-methyl-
• 1,2,3,4-Tetrahydro-8-methyl-5-quinolinecarboxylic acid
• 8-Methyl-1,2,3,4-tetrahydroquinoline-5-carboxylic acid