CAS 118128-78-2
:1,2,3,4-Tetrahydroquinoline-5-carboxylic acid ethyl ester
Description:
1,2,3,4-Tetrahydroquinoline-5-carboxylic acid ethyl ester is an organic compound characterized by its bicyclic structure, which includes a quinoline moiety. This compound features a tetrahydroquinoline ring, indicating that it has undergone partial hydrogenation, resulting in a saturated form of the quinoline. The presence of a carboxylic acid ester functional group contributes to its reactivity and solubility properties, making it a versatile intermediate in organic synthesis. Typically, such esters are known for their ability to undergo hydrolysis, transesterification, and other nucleophilic substitution reactions. The ethyl ester form suggests that it may exhibit moderate volatility and is likely to be soluble in organic solvents. Additionally, compounds of this class may possess biological activity, making them of interest in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, 1,2,3,4-Tetrahydroquinoline-5-carboxylic acid ethyl ester is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H15NO2
InChI:InChI=1/C12H15NO2/c1-2-15-12(14)10-5-3-7-11-9(10)6-4-8-13-11/h3,5,7,13H,2,4,6,8H2,1H3
SMILES:CCOC(=O)c1cccc2c1CCCN2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
