CAS 118128-79-3

Ethyl 1,2,3,4-tetrahydro-8-quinolinecarboxylate

Description:

Ethyl 1,2,3,4-tetrahydro-8-quinolinecarboxylate is a chemical compound characterized by its unique structure, which includes a quinoline ring fused with a tetrahydro moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the ethyl ester group contributes to its solubility in organic solvents, making it suitable for various synthetic reactions. Additionally, the compound may exhibit interesting biological activities, including antimicrobial or anti-inflammatory properties, although specific activities can vary based on structural modifications and the presence of substituents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Ethyl 1,2,3,4-tetrahydro-8-quinolinecarboxylate represents a versatile building block in organic synthesis and drug discovery.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1S/C12H15NO2/c1-2-15-12(14)10-7-3-5-9-6-4-8-13-11(9)10/h3,5,7,13H,2,4,6,8H2,1H3

InChI key: InChIKey=ARCBMLYSIMSYFQ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C2C(=CC=C1)CCCN2

Synonyms:

• 8-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-, ethyl ester
• Ethyl 1,2,3,4-tetrahydro-8-quinolinecarboxylate