CAS 118132-11-9
:4,5-dioctyloxy-1,2-benzenedicarbonitrile
Description:
4,5-Dioctyloxy-1,2-benzenedicarbonitrile is an organic compound characterized by its unique structure, which includes a benzene ring substituted with two cyano groups and two octyloxy chains. The presence of the cyano groups (-C≡N) contributes to its polarity and potential reactivity, while the long octyloxy chains enhance its solubility in organic solvents and may influence its physical properties, such as melting and boiling points. This compound is typically used in materials science, particularly in the development of liquid crystals and organic semiconductors, due to its ability to form ordered structures. Its molecular design allows for tunable electronic properties, making it suitable for applications in electronic devices. Additionally, the presence of the octyloxy groups can provide flexibility and improve the thermal stability of the compound. Overall, 4,5-dioctyloxy-1,2-benzenedicarbonitrile is notable for its potential applications in advanced materials and its interesting chemical behavior stemming from its functional groups.
Formula:C24H36N2O2
InChI:InChI=1/C24H36N2O2/c1-3-5-7-9-11-13-15-27-23-17-21(19-25)22(20-26)18-24(23)28-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3
SMILES:CCCCCCCCOc1cc(C#N)c(cc1OCCCCCCCC)C#N
Synonyms:- 4,5-Bis(Octyloxy)Benzene-1,2-Dicarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
