CAS 118134-22-8

N-(7-Chloro-1H-benzimidazol-5-yl)formamide

Description:

N-(7-Chloro-1H-benzimidazol-5-yl)formamide is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a chloro substituent at the 7-position of the benzimidazole ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The formamide functional group indicates that the compound contains a carbonyl group (C=O) directly attached to a nitrogen atom, which can participate in hydrogen bonding and may enhance solubility in polar solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of therapeutic agents. Its molecular structure suggests that it may exhibit specific interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the chloro group and the overall molecular conformation.

Formula: C₈H₆ClN₃O

InChI: InChI=1S/C8H6ClN3O/c9-6-1-5(12-4-13)2-7-8(6)11-3-10-7/h1-4H,(H,10,11)(H,12,13)

InChI key: InChIKey=PWBRDMXGZPMJJK-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(NC=O)=C1)NC=N2

Synonyms:

• N-(7-Chloro-1H-benzimidazol-5-yl)formamide
• Formamide, N-(7-chloro-1H-benzimidazol-5-yl)-