CAS 118143-28-5
:1-(Trifluoromethyl)-2-cyclohexen-1-ol
Description:
1-(Trifluoromethyl)-2-cyclohexen-1-ol is an organic compound characterized by the presence of a cyclohexene ring, which is a six-membered carbon ring containing one double bond. The trifluoromethyl group (-CF3) is a notable feature, imparting unique electronic and steric properties that can influence the compound's reactivity and interactions. This compound is typically colorless to pale yellow in appearance and is soluble in organic solvents. Its structure suggests potential applications in pharmaceuticals and agrochemicals due to the trifluoromethyl group, which can enhance biological activity and lipophilicity. The presence of the hydroxyl group (-OH) indicates that it can participate in hydrogen bonding, affecting its solubility and reactivity. Additionally, the compound may exhibit interesting chemical behavior under various conditions, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling and storage, as the trifluoromethyl group can also influence toxicity and environmental impact.
Formula:C7H9F3O
InChI:InChI=1S/C7H9F3O/c8-7(9,10)6(11)4-2-1-3-5-6/h2,4,11H,1,3,5H2
InChI key:InChIKey=DFFKUOBCTWPVOA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(O)CCCC=C1
Synonyms:- 1-(Trifluoromethyl)-2-cyclohexen-1-ol
- 2-Cyclohexen-1-ol, 1-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.