CAS 1181447-88-0

N4,N4-Diethyl-2,4-thiazoledimethanamine

Description:

N4,N4-Diethyl-2,4-thiazoledimethanamine is a chemical compound characterized by its unique thiazole structure, which incorporates both sulfur and nitrogen within a five-membered ring. This compound features two ethyl groups attached to the nitrogen atom, contributing to its overall hydrophobic character. The thiazole ring is known for its biological activity, often serving as a scaffold in medicinal chemistry. The presence of the dimethanamine functional group suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit properties such as solubility in organic solvents and moderate stability under standard laboratory conditions. Its specific applications can vary, but it may be explored in pharmaceutical research due to its structural features that could interact with biological targets. As with many thiazole derivatives, it may also possess interesting electronic properties, making it a candidate for further study in materials science or organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₇N₃S

InChI: InChI=1S/C9H17N3S/c1-3-12(4-2)6-8-7-13-9(5-10)11-8/h7H,3-6,10H2,1-2H3

InChI key: InChIKey=XPVCMQHQCIJLMF-UHFFFAOYSA-N

SMILES: C(N(CC)CC)C=1N=C(CN)SC1

Synonyms:

• N4,N4-Diethyl-2,4-thiazoledimethanamine
• 2,4-Thiazoledimethanamine, N4,N4-diethyl-