CAS 1181457-76-0

3-Piperidinecarboxamide, N-(4,5-dihydro-1-methyl-4-oxo-1H-imidazol-2-yl)-, hydrochloride (1:2)

Description:

3-Piperidinecarboxamide, N-(4,5-dihydro-1-methyl-4-oxo-1H-imidazol-2-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and imidazole moieties, which contribute to its biological activity. The piperidine ring provides a basic nitrogen atom, enhancing its solubility in polar solvents, while the imidazole structure is known for its role in various biological processes, including enzyme catalysis and receptor binding. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on its interaction with biological targets. Its molecular structure suggests potential for use in medicinal chemistry, particularly in the development of therapeutics. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and therapeutic potential.

Formula: C₁₀H₁₆N₄O₂·2ClH

InChI: InChI=1S/C10H16N4O2.2ClH/c1-14-6-8(15)12-10(14)13-9(16)7-3-2-4-11-5-7;;/h7,11H,2-6H2,1H3,(H,12,13,15,16);2*1H

InChI key: InChIKey=RUGWIFQPPAOWNV-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCCNC1)C2=NC(=O)CN2C.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-(4,5-dihydro-1-methyl-4-oxo-1H-imidazol-2-yl)-, hydrochloride (1:2)