CAS 1181457-82-8
:5-(2-Chloroethyl)-1-phenyl-1H-tetrazole
Description:
5-(2-Chloroethyl)-1-phenyl-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. This compound features a phenyl group and a chloroethyl substituent, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chloroethyl group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The tetrazole moiety is known for its biological activity, often exhibiting properties such as antimicrobial and anti-inflammatory effects. Additionally, the compound's structure may influence its solubility, stability, and interaction with biological targets. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 5-(2-Chloroethyl)-1-phenyl-1H-tetrazole represents a versatile compound with significant implications in chemical research and development.
Formula:C9H9ClN4
InChI:InChI=1S/C9H9ClN4/c10-7-6-9-11-12-13-14(9)8-4-2-1-3-5-8/h1-5H,6-7H2
InChI key:InChIKey=LQGMOBKRYYBVQB-UHFFFAOYSA-N
SMILES:C(CCl)C=1N(N=NN1)C2=CC=CC=C2
Synonyms:- 1H-Tetrazole, 5-(2-chloroethyl)-1-phenyl-
- 5-(2-Chloroethyl)-1-phenyl-1H-tetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.