
CAS 1181457-84-0
:1-Piperazinebutanamine, 4-phenyl-, hydrochloride (1:1)
Description:
1-Piperazinebutanamine, 4-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine and phenyl functional groups, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperazine ring suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry for developing psychoactive or therapeutic agents. Its structure may also indicate possible uses in the synthesis of other compounds or as a ligand in coordination chemistry. The compound's molecular weight, melting point, and specific solubility characteristics would be relevant for practical applications, although these specific values are not provided here. Safety data, including toxicity and handling precautions, should be consulted from reliable sources when working with this substance, as with any chemical compound.
Formula:C14H23N3·ClH
InChI:InChI=1S/C14H23N3.ClH/c15-8-4-5-9-16-10-12-17(13-11-16)14-6-2-1-3-7-14;/h1-3,6-7H,4-5,8-13,15H2;1H
InChI key:InChIKey=YWCPIQJSWGSXRG-UHFFFAOYSA-N
SMILES:C(CCCN)N1CCN(CC1)C2=CC=CC=C2.Cl
Synonyms:- 1-Piperazinebutanamine, 4-phenyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.