CAS 1181457-85-1

2-[(2,3-Dihydro-2,3-dioxo-1H-indol-6-yl)thio]acetic acid

Description:

2-[(2,3-Dihydro-2,3-dioxo-1H-indol-6-yl)thio]acetic acid is a chemical compound characterized by its unique structure, which includes an indole moiety with a thioether linkage and a carboxylic acid functional group. This compound features a bicyclic indole structure that contributes to its potential biological activity. The presence of the thioether group enhances its reactivity and may influence its solubility and interaction with biological targets. The dioxo functionality suggests the potential for tautomerism and reactivity under certain conditions. As a derivative of indole, it may exhibit properties typical of indole-based compounds, such as fluorescence or involvement in various biochemical pathways. The compound's specific applications or biological activities would depend on further studies, including its pharmacological profile and potential therapeutic uses. Overall, 2-[(2,3-Dihydro-2,3-dioxo-1H-indol-6-yl)thio]acetic acid represents a complex organic molecule with potential significance in medicinal chemistry and drug development.

Formula: C₁₀H₇NO₄S

InChI: InChI=1S/C10H7NO4S/c12-8(13)4-16-5-1-2-6-7(3-5)11-10(15)9(6)14/h1-3H,4H2,(H,12,13)(H,11,14,15)

InChI key: InChIKey=CCIUSUPFIAONFI-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(SCC(O)=O)=CC2)NC1=O

Synonyms:

• Acetic acid, 2-[(2,3-dihydro-2,3-dioxo-1H-indol-6-yl)thio]-
• 2-[(2,3-Dihydro-2,3-dioxo-1H-indol-6-yl)thio]acetic acid